ChemNet > CAS > 423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol
423769-75-9 (1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol
produktnavn |
(1,3-dimethyl-1H-thieno[2,3-c]pyrazol-5-yl)methanol |
Molekylær Formel |
C8H10N2OS |
Molekylvekt |
182.2428 |
InChI |
InChI=1/C8H10N2OS/c1-5-7-3-6(4-11)12-8(7)10(2)9-5/h3,11H,4H2,1-2H3 |
CAS-nummer |
423769-75-9 |
Molecular Structure |
|
Tetthet |
1.4g/cm3 |
Smeltepunkt |
133℃ |
Kokepunkt |
351.2°C at 760 mmHg |
Brytningsindeks |
1.69 |
Flammepunktet |
166.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|